C29H32N4O2 — CID 135961249
7,7-diethyl-5-(2-phenylmethoxyethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one (PubChem CID 135961249) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 7,7-diethyl-5-(2-phenylmethoxyethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one.
| Compound Name | 7,7-diethyl-5-(2-phenylmethoxyethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
|---|---|
| PubChem CID | 135961249 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 7,7-diethyl-5-(2-phenylmethoxyethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
| SMILES | CCC1(CC)C(=O)N(CCOCc2ccccc2)c2cc3c4c([nH]c3cc21)-c1[nH]ncc1CCC4 |
| InChI | InChI=1S/C29H32N4O2/c1-3-29(4-2)23-16-24-22(21-12-8-11-20-17-30-32-26(20)27(21)31-24)15-25(23)33(28(29)34)13-14-35-18-19-9-6-5-7-10-19/h5-7,9-10,15-17,31H,3-4,8,11-14,18H2,1-2H3,(H,30,32) |
| InChIKey | NONXKCOOZGSONW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|