C21H24N4O2 — CID 135961271
5-(3-hydroxypropyl)-7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one (PubChem CID 135961271) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)-7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one.
| Compound Name | 5-(3-hydroxypropyl)-7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
|---|---|
| PubChem CID | 135961271 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 5-(3-hydroxypropyl)-7,7-dimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
| SMILES | CC1(C)C(=O)N(CCCO)c2cc3c4c([nH]c3cc21)-c1[nH]ncc1CCC4 |
| InChI | InChI=1S/C21H24N4O2/c1-21(2)15-10-16-14(9-17(15)25(20(21)27)7-4-8-26)13-6-3-5-12-11-22-24-18(12)19(13)23-16/h9-11,23,26H,3-8H2,1-2H3,(H,22,24) |
| InChIKey | HWNUQJZHIPBGNM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|