C25H32N4O5 — CID 135961306
5-[2-(2-methoxyethoxy)ethyl]-7,7-bis(methoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one (PubChem CID 135961306) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 5-[2-(2-methoxyethoxy)ethyl]-7,7-bis(methoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one.
| Compound Name | 5-[2-(2-methoxyethoxy)ethyl]-7,7-bis(methoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
|---|---|
| PubChem CID | 135961306 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 5-[2-(2-methoxyethoxy)ethyl]-7,7-bis(methoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
| SMILES | COCCOCCN1C(=O)C(COC)(COC)c2cc3[nH]c4c(c3cc21)CCCc1cn[nH]c1-4 |
| InChI | InChI=1S/C25H32N4O5/c1-31-9-10-34-8-7-29-21-11-18-17-6-4-5-16-13-26-28-22(16)23(17)27-20(18)12-19(21)25(14-32-2,15-33-3)24(29)30/h11-13,27H,4-10,14-15H2,1-3H3,(H,26,28) |
| InChIKey | PUJUWNYHSKXOIJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|