C20H23N5O — CID 135961329
5,7-diethyl-16-methyl-5,7,11,14,15-pentazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one (PubChem CID 135961329) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 5,7-diethyl-16-methyl-5,7,11,14,15-pentazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one.
| Compound Name | 5,7-diethyl-16-methyl-5,7,11,14,15-pentazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one |
|---|---|
| PubChem CID | 135961329 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 5,7-diethyl-16-methyl-5,7,11,14,15-pentazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one |
| SMILES | CCn1c(=O)n(CC)c2cc3c4c([nH]c3cc21)-c1n[nH]c(C)c1CCC4 |
| InChI | InChI=1S/C20H23N5O/c1-4-24-16-9-14-13-8-6-7-12-11(3)22-23-19(12)18(13)21-15(14)10-17(16)25(5-2)20(24)26/h9-10,21H,4-8H2,1-3H3,(H,22,23) |
| InChIKey | IPFMYKBBSKCGOF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|