C34H34N4O3 — CID 135961368
5-ethyl-7,7-bis(phenylmethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one (PubChem CID 135961368) has the molecular formula C34H34N4O3 and a molecular weight of 546.67 g/mol. Its IUPAC name is 5-ethyl-7,7-bis(phenylmethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one.
| Compound Name | 5-ethyl-7,7-bis(phenylmethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
|---|---|
| PubChem CID | 135961368 |
| Molecular Formula | C34H34N4O3 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 5-ethyl-7,7-bis(phenylmethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
| SMILES | CCN1C(=O)C(COCc2ccccc2)(COCc2ccccc2)c2cc3[nH]c4c(c3cc21)CCCc1cn[nH]c1-4 |
| InChI | InChI=1S/C34H34N4O3/c1-2-38-30-16-27-26-15-9-14-25-18-35-37-31(25)32(26)36-29(27)17-28(30)34(33(38)39,21-40-19-23-10-5-3-6-11-23)22-41-20-24-12-7-4-8-13-24/h3-8,10-13,16-18,36H,2,9,14-15,19-22H2,1H3,(H,35,37) |
| InChIKey | PLQNEVYGRDEUBA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|