C11H9N3O3S2 — CID 135961509
ethyl 3-methyl-9-oxo-4,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,11-tetraene-11-carboxylate (PubChem CID 135961509) has the molecular formula C11H9N3O3S2 and a molecular weight of 295.35 g/mol. Its IUPAC name is ethyl 3-methyl-9-oxo-4,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,11-tetraene-11-carboxylate.
| Compound Name | ethyl 3-methyl-9-oxo-4,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,11-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 135961509 |
| Molecular Formula | C11H9N3O3S2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | ethyl 3-methyl-9-oxo-4,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,11-tetraene-11-carboxylate |
| SMILES | CCOC(=O)c1nc2c(sc3nsc(C)c32)c(=O)[nH]1 |
| InChI | InChI=1S/C11H9N3O3S2/c1-3-17-11(16)8-12-6-5-4(2)19-14-10(5)18-7(6)9(15)13-8/h3H2,1-2H3,(H,12,13,15) |
| InChIKey | DPPQKQNIMWZLJV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |