About 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten
2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten (PubChem CID 135961620) has the molecular formula C9H12N3O4W-
and a molecular weight of 410.05 g/mol. Its IUPAC name is 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten.
Molecular Properties
| Compound Name | 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten |
| PubChem CID | 135961620 |
| Molecular Formula | C9H12N3O4W- |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten |
| SMILES | COC(=O)c1nc(C(C)(C)[NH-])[nH]c(=O)c1O.[W] |
| InChI | InChI=1S/C9H12N3O4.W/c1-9(2,10)8-11-4(7(15)16-3)5(13)6(14)12-8;/h10,13H,1-3H3,(H,11,12,14);/q-1; |
| InChIKey | UKOXFGYNKNVMKA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten?
The IUPAC name of 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten (CID 135961620) is 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten.
What is the SMILES notation for 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten?
The canonical SMILES for 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten is COC(=O)c1nc(C(C)(C)[NH-])[nH]c(=O)c1O.[W].
What is the InChIKey of 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten?
The InChIKey is UKOXFGYNKNVMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N3O4.W/c1-9(2,10)8-11-4(7(15)16-3)5(13)6(14)12-8;/h10,13H,1-3H3,(H,11,12,14);/q-1;.
What are the key properties of 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten?
2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten has a molecular weight of 410.05 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)propan-2-ylazanide;tungsten is sourced from PubChem (CID 135961620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).