C24H26ClN3O3 — CID 135962404
N-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-4-(4-ethylphenyl)-4-oxo-N-propylbutanamide (PubChem CID 135962404) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is N-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-4-(4-ethylphenyl)-4-oxo-N-propylbutanamide.
| Compound Name | N-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-4-(4-ethylphenyl)-4-oxo-N-propylbutanamide |
|---|---|
| PubChem CID | 135962404 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-4-(4-ethylphenyl)-4-oxo-N-propylbutanamide |
| SMILES | CCCN(Cc1nc2cc(Cl)ccc2c(=O)[nH]1)C(=O)CCC(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-3-13-28(15-22-26-20-14-18(25)9-10-19(20)24(31)27-22)23(30)12-11-21(29)17-7-5-16(4-2)6-8-17/h5-10,14H,3-4,11-13,15H2,1-2H3,(H,26,27,31) |
| InChIKey | QAPFKGIAQJQROV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |