C51H38N4O4 — CID 135962702
2-(2-methylprop-2-enoyloxy)ethyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate (PubChem CID 135962702) has the molecular formula C51H38N4O4 and a molecular weight of 770.89 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate |
|---|---|
| PubChem CID | 135962702 |
| Molecular Formula | C51H38N4O4 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.29 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C51H38N4O4/c1-32(2)50(56)58-30-31-59-51(57)37-20-18-36(19-21-37)49-44-28-26-42(54-44)47(34-14-8-4-9-15-34)40-24-22-38(52-40)46(33-12-6-3-7-13-33)39-23-25-41(53-39)48(35-16-10-5-11-17-35)43-27-29-45(49)55-43/h3-29,52,55H,1,30-31H2,2H3/b46-38-,46-39-,47-40-,47-42-,48-41-,48-43-,49-44-,49-45- |
| InChIKey | KDMWZOKUMRGPIF-VUXQGAMNSA-N |
| XLogP | 11.60 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|