C16H17N5O2 — CID 135962822
2-(oxan-4-ylamino)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1H-pyrimidin-6-one (PubChem CID 135962822) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(oxan-4-ylamino)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-(oxan-4-ylamino)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135962822 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-(oxan-4-ylamino)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2c[nH]c3ncccc23)nc(NC2CCOCC2)[nH]1 |
| InChI | InChI=1S/C16H17N5O2/c22-14-8-13(12-9-18-15-11(12)2-1-5-17-15)20-16(21-14)19-10-3-6-23-7-4-10/h1-2,5,8-10H,3-4,6-7H2,(H,17,18)(H2,19,20,21,22) |
| InChIKey | JRYZKNITVQQTFF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |