C15H14N2O6 — CID 135963051
2-[(2-hydroxy-5-nitrophenyl)iminomethyl]-3,5-dimethoxyphenol (PubChem CID 135963051) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-nitrophenyl)iminomethyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(2-hydroxy-5-nitrophenyl)iminomethyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 135963051 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[(2-hydroxy-5-nitrophenyl)iminomethyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(/C=N/c2cc([N+](=O)[O-])ccc2O)c(OC)c1 |
| InChI | InChI=1S/C15H14N2O6/c1-22-10-6-14(19)11(15(7-10)23-2)8-16-12-5-9(17(20)21)3-4-13(12)18/h3-8,18-19H,1-2H3/b16-8+ |
| InChIKey | ZREBSNWEPSGOPS-LZYBPNLTSA-N |
| XLogP | 2.77 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|