C18H25F3N4O — CID 135963330
cyclopropyl-[(3R)-3-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 135963330) has the molecular formula C18H25F3N4O and a molecular weight of 370.42 g/mol. Its IUPAC name is cyclopropyl-[(3R)-3-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3R)-3-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 135963330 |
| Molecular Formula | C18H25F3N4O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | cyclopropyl-[(3R)-3-[(5S,7R)-5-propan-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | CC(C)[C@@H]1C[C@H](C(F)(F)F)n2nc([C@@H]3CCN(C(=O)C4CC4)C3)cc2N1 |
| InChI | InChI=1S/C18H25F3N4O/c1-10(2)13-7-15(18(19,20)21)25-16(22-13)8-14(23-25)12-5-6-24(9-12)17(26)11-3-4-11/h8,10-13,15,22H,3-7,9H2,1-2H3/t12-,13+,15-/m1/s1 |
| InChIKey | CLBWDPZFSBDBOA-VNHYZAJKSA-N |
| XLogP | 3.55 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |