C20H20N4O3 — CID 135963448
2-(4-methoxyphenyl)-N-[(1R)-1-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-4-yl)ethyl]acetamide (PubChem CID 135963448) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(1R)-1-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-4-yl)ethyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(1R)-1-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 135963448 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(1R)-1-(6-oxo-2-pyridin-3-yl-1H-pyrimidin-4-yl)ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)N[C@H](C)c2cc(=O)[nH]c(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C20H20N4O3/c1-13(22-18(25)10-14-5-7-16(27-2)8-6-14)17-11-19(26)24-20(23-17)15-4-3-9-21-12-15/h3-9,11-13H,10H2,1-2H3,(H,22,25)(H,23,24,26)/t13-/m1/s1 |
| InChIKey | MMHMZBBBRLXLGI-CYBMUJFWSA-N |
| XLogP | 2.26 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |