C19H23N3O3 — CID 135963718
2-[(2R)-1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135963718) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[(2R)-1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2R)-1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135963718 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[(2R)-1-[2-(4-ethoxyphenyl)acetyl]pyrrolidin-2-yl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCOc1ccc(CC(=O)N2CCC[C@@H]2c2nc(C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-3-25-15-8-6-14(7-9-15)12-18(24)22-10-4-5-16(22)19-20-13(2)11-17(23)21-19/h6-9,11,16H,3-5,10,12H2,1-2H3,(H,20,21,23)/t16-/m1/s1 |
| InChIKey | TUHPCTXUGJFEON-MRXNPFEDSA-N |
| XLogP | 2.38 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |