C11H13N4O2S- — CID 135964048
1H-1,2,4-triazol-5-yl-(2,4,6-trimethylphenyl)sulfonylazanide (PubChem CID 135964048) has the molecular formula C11H13N4O2S- and a molecular weight of 265.32 g/mol. Its IUPAC name is 1H-1,2,4-triazol-5-yl-(2,4,6-trimethylphenyl)sulfonylazanide.
| Compound Name | 1H-1,2,4-triazol-5-yl-(2,4,6-trimethylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 135964048 |
| Molecular Formula | C11H13N4O2S- |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1H-1,2,4-triazol-5-yl-(2,4,6-trimethylphenyl)sulfonylazanide |
| SMILES | Cc1cc(C)c(S(=O)(=O)[N-]c2ncn[nH]2)c(C)c1 |
| InChI | InChI=1S/C11H13N4O2S/c1-7-4-8(2)10(9(3)5-7)18(16,17)15-11-12-6-13-14-11/h4-6H,1-3H3,(H-,12,13,14,15)/q-1 |
| InChIKey | QSIDBKHMQDVCNJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |