C20H20N2O — CID 135964179
6-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine (PubChem CID 135964179) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine.
| Compound Name | 6-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 135964179 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 6-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine |
| SMILES | c1ccc2c(c1)CC[C@H]2/N=C1/Nc2ccc(C3CC3)cc2CO1 |
| InChI | InChI=1S/C20H20N2O/c1-2-4-17-14(3-1)7-10-19(17)22-20-21-18-9-8-15(13-5-6-13)11-16(18)12-23-20/h1-4,8-9,11,13,19H,5-7,10,12H2,(H,21,22)/t19-/m1/s1 |
| InChIKey | SKEMRRKOAHVYSY-LJQANCHMSA-N |
| XLogP | 4.55 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|