C13H17NO7 — CID 135964403
(4S,6S)-2-(hydroxymethyl)-6-[(E)-(2-hydroxyphenyl)methylideneamino]oxyoxane-3,4,5-triol (PubChem CID 135964403) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is (4S,6S)-2-(hydroxymethyl)-6-[(E)-(2-hydroxyphenyl)methylideneamino]oxyoxane-3,4,5-triol.
| Compound Name | (4S,6S)-2-(hydroxymethyl)-6-[(E)-(2-hydroxyphenyl)methylideneamino]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 135964403 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (4S,6S)-2-(hydroxymethyl)-6-[(E)-(2-hydroxyphenyl)methylideneamino]oxyoxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](O/N=C/c2ccccc2O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C13H17NO7/c15-6-9-10(17)11(18)12(19)13(20-9)21-14-5-7-3-1-2-4-8(7)16/h1-5,9-13,15-19H,6H2/b14-5+/t9?,10?,11-,12?,13-/m0/s1 |
| InChIKey | ZBAKMJQOUSYXJI-SGIGLYMQSA-N |
| XLogP | -1.46 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|