C13H10N6O5S — CID 135964419
2-amino-5-(3,5-dinitrophenyl)sulfanyl-6-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135964419) has the molecular formula C13H10N6O5S and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-amino-5-(3,5-dinitrophenyl)sulfanyl-6-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-(3,5-dinitrophenyl)sulfanyl-6-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135964419 |
| Molecular Formula | C13H10N6O5S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-amino-5-(3,5-dinitrophenyl)sulfanyl-6-methyl-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1[nH]c2nc(N)[nH]c(=O)c2c1Sc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N6O5S/c1-5-10(9-11(15-5)16-13(14)17-12(9)20)25-8-3-6(18(21)22)2-7(4-8)19(23)24/h2-4H,1H3,(H4,14,15,16,17,20) |
| InChIKey | IYPMQKXLCJQBQC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|