About 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one
2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one (PubChem CID 135964430) has the molecular formula C23H26N6O2
and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one.
Molecular Properties
| Compound Name | 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one |
| PubChem CID | 135964430 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one |
| SMILES | CCOc1ccccc1-c1nc2c(nc3cccc(CN4CCN(C)CC4)n32)c(=O)[nH]1 |
| InChI | InChI=1S/C23H26N6O2/c1-3-31-18-9-5-4-8-17(18)21-25-22-20(23(30)26-21)24-19-10-6-7-16(29(19)22)15-28-13-11-27(2)12-14-28/h4-10H,3,11-15H2,1-2H3,(H,25,26,30) |
| InChIKey | VSPYKVYRKPIICK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one?
The IUPAC name of 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one (CID 135964430) is 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one.
What is the SMILES notation for 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one?
The canonical SMILES for 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one is CCOc1ccccc1-c1nc2c(nc3cccc(CN4CCN(C)CC4)n32)c(=O)[nH]1.
What is the InChIKey of 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one?
The InChIKey is VSPYKVYRKPIICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N6O2/c1-3-31-18-9-5-4-8-17(18)21-25-22-20(23(30)26-21)24-19-10-6-7-16(29(19)22)15-28-13-11-27(2)12-14-28/h4-10H,3,11-15H2,1-2H3,(H,25,26,30).
What are the key properties of 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one?
2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one has a molecular weight of 418.50 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyphenyl)-9-[(4-methylpiperazin-1-yl)methyl]-3H-purino[9,8-a]pyridin-4-one is sourced from PubChem (CID 135964430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).