About 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol
5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol (PubChem CID 135964580) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol |
| PubChem CID | 135964580 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol |
| SMILES | CN1CCN(/N=C\c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C12H17N3O3/c1-14-2-4-15(5-3-14)13-8-9-6-10(16)12(18)11(17)7-9/h6-8,16-18H,2-5H2,1H3/b13-8- |
| InChIKey | GNKVKGXZWIXFOU-JYRVWZFOSA-N |
| XLogP | 0.38 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol?
The IUPAC name of 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol (CID 135964580) is 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol.
What is the SMILES notation for 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol?
The canonical SMILES for 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol is CN1CCN(/N=C\c2cc(O)c(O)c(O)c2)CC1.
What is the InChIKey of 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol?
The InChIKey is GNKVKGXZWIXFOU-JYRVWZFOSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-14-2-4-15(5-3-14)13-8-9-6-10(16)12(18)11(17)7-9/h6-8,16-18H,2-5H2,1H3/b13-8-.
What are the key properties of 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol?
5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol has a molecular weight of 251.29 g/mol, XLogP of 0.38, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol is sourced from PubChem (CID 135964580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).