5-hydroxy-2-methylquinoline-6-carboxylic acid

C11H9NO3 — CID 135964599

IUPAC5-hydroxy-2-methylquinoline-6-carboxylic acid
SMILESCc1ccc2c(O)c(C(=O)O)ccc2n1
InChIInChI=1S/C11H9NO3/c1-6-2-3-7-9(12-6)5-4-8(10(7)13)11(14)15/h2-5,13H,1H3,(H,14,15)
InChIKeyVUKWLYLGIHTCKZ-UHFFFAOYSA-N
MW203.20 g/mol
LogP1.95
Rot. Bonds1

About 5-hydroxy-2-methylquinoline-6-carboxylic acid

5-hydroxy-2-methylquinoline-6-carboxylic acid (PubChem CID 135964599) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-hydroxy-2-methylquinoline-6-carboxylic acid.

Molecular Properties

Compound Name5-hydroxy-2-methylquinoline-6-carboxylic acid
PubChem CID135964599
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name5-hydroxy-2-methylquinoline-6-carboxylic acid
SMILESCc1ccc2c(O)c(C(=O)O)ccc2n1
InChIInChI=1S/C11H9NO3/c1-6-2-3-7-9(12-6)5-4-8(10(7)13)11(14)15/h2-5,13H,1H3,(H,14,15)
InChIKeyVUKWLYLGIHTCKZ-UHFFFAOYSA-N
XLogP1.95
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-hydroxy-2-methylquinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-Quinolinecarboxylic acid, 3-hydroxy-2-methyl-
CID 67024
2,6-Dimethylquinoline-3-carboxylic acid
CID 3159812
2-(3-Carboxy-4-hydroxyphenyl)quinoline-4-carboxylic acid
CID 68234
2-Methyl-3-quinolinecarboxylic acid
CID 1481999
2-Methylquinoline-6-carboxylic acid
CID 604483
4-(2,5-dimethyl-1H-pyrrol-1-yl)-2-hydroxybenzoic acid
CID 668744
2-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]benzoic acid
CID 10502268
5-tert-butyl-2-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]benzoic acid
CID 10624458
2-Hydroxy-5-methyl-3-(3-(3-(2-(quinolin-2-yl)vinyl)phenyl)acryloyl)benzoic acid
CID 10646529
2-hydroxy-3-[(E)-3-[4-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]benzoic acid
CID 10669858
5-fluoro-2-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]benzoic acid
CID 10812959
2-Ethylquinoline-3-carboxylic acid
CID 17933414

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-2-methylquinoline-6-carboxylic acid?
The IUPAC name of 5-hydroxy-2-methylquinoline-6-carboxylic acid (CID 135964599) is 5-hydroxy-2-methylquinoline-6-carboxylic acid.
What is the SMILES notation for 5-hydroxy-2-methylquinoline-6-carboxylic acid?
The canonical SMILES for 5-hydroxy-2-methylquinoline-6-carboxylic acid is Cc1ccc2c(O)c(C(=O)O)ccc2n1.
What is the InChIKey of 5-hydroxy-2-methylquinoline-6-carboxylic acid?
The InChIKey is VUKWLYLGIHTCKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-6-2-3-7-9(12-6)5-4-8(10(7)13)11(14)15/h2-5,13H,1H3,(H,14,15).
What are the key properties of 5-hydroxy-2-methylquinoline-6-carboxylic acid?
5-hydroxy-2-methylquinoline-6-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 1.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methylquinoline-6-carboxylic acid is sourced from PubChem (CID 135964599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).