C16H17N5O2 — CID 135965607
6-[(5-methoxy-2,3-dihydroindol-1-yl)methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135965607) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 6-[(5-methoxy-2,3-dihydroindol-1-yl)methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[(5-methoxy-2,3-dihydroindol-1-yl)methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135965607 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 6-[(5-methoxy-2,3-dihydroindol-1-yl)methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | COc1ccc2c(c1)CCN2Cc1nc2c(cnn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17N5O2/c1-20-15-12(8-17-20)16(22)19-14(18-15)9-21-6-5-10-7-11(23-2)3-4-13(10)21/h3-4,7-8H,5-6,9H2,1-2H3,(H,18,19,22) |
| InChIKey | CNHDWTSMYFGXTQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|