C30H28N2O9 — CID 135965920
3-[(E)-(tert-butylhydrazinylidene)methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid (PubChem CID 135965920) has the molecular formula C30H28N2O9 and a molecular weight of 560.56 g/mol. Its IUPAC name is 3-[(E)-(tert-butylhydrazinylidene)methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid.
| Compound Name | 3-[(E)-(tert-butylhydrazinylidene)methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 135965920 |
| Molecular Formula | C30H28N2O9 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 3-[(E)-(tert-butylhydrazinylidene)methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1c(cc(O)c(C)c1O)C3=O)-c1c(cc(/C=N/NC(C)(C)C)c(C(=O)O)c1O)CC2 |
| InChI | InChI=1S/C30H28N2O9/c1-11-16(33)9-15-20(23(11)34)27(38)22-21(24(15)35)26(37)19-14(28(22)41-5)7-6-12-8-13(10-31-32-30(2,3)4)18(29(39)40)25(36)17(12)19/h8-10,32-34,36-37H,6-7H2,1-5H3,(H,39,40)/b31-10+ |
| InChIKey | XNZUQECGGOBESW-VNTWQREPSA-N |
| XLogP | 3.79 |
| TPSA | 185.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|