C9H15BrN5O5P — CID 135965952
[(2R)-1-(2-amino-8-bromo-6-oxo-7,8-dihydro-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid (PubChem CID 135965952) has the molecular formula C9H15BrN5O5P and a molecular weight of 384.13 g/mol. Its IUPAC name is [(2R)-1-(2-amino-8-bromo-6-oxo-7,8-dihydro-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-(2-amino-8-bromo-6-oxo-7,8-dihydro-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 135965952 |
| Molecular Formula | C9H15BrN5O5P |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | [(2R)-1-(2-amino-8-bromo-6-oxo-7,8-dihydro-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid |
| SMILES | C[C@H](CN1c2nc(N)[nH]c(=O)c2NC1Br)OCP(=O)(O)O |
| InChI | InChI=1S/C9H15BrN5O5P/c1-4(20-3-21(17,18)19)2-15-6-5(12-8(15)10)7(16)14-9(11)13-6/h4,8,12H,2-3H2,1H3,(H2,17,18,19)(H3,11,13,14,16)/t4-,8?/m1/s1 |
| InChIKey | AOXUTPPKHNPZPN-WZIMWHJTSA-N |
| XLogP | -0.20 |
| TPSA | 153.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|