C12H16N4O5S — CID 135965956
9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-hydroxyethylsulfanylmethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135965956) has the molecular formula C12H16N4O5S and a molecular weight of 328.35 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-hydroxyethylsulfanylmethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-hydroxyethylsulfanylmethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135965956 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(2-hydroxyethylsulfanylmethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](CSCCO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N4O5S/c17-1-2-22-3-6-8(18)9(19)12(21-6)16-5-15-7-10(16)13-4-14-11(7)20/h4-6,8-9,12,17-19H,1-3H2,(H,13,14,20)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | XEFPSNCCUZFZKD-WOUKDFQISA-N |
| XLogP | -1.54 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|