C25H29NO2 — CID 135966048
2-(cyclohexyliminomethyl)-6-(4-hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol (PubChem CID 135966048) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-(cyclohexyliminomethyl)-6-(4-hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol.
| Compound Name | 2-(cyclohexyliminomethyl)-6-(4-hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 135966048 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-(cyclohexyliminomethyl)-6-(4-hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(/C=N/C2CCCCC2)c(O)c(-c2ccc(O)c(CC=C)c2)c1 |
| InChI | InChI=1S/C25H29NO2/c1-3-8-18-14-21(17-26-22-10-6-5-7-11-22)25(28)23(15-18)19-12-13-24(27)20(16-19)9-4-2/h3-4,12-17,22,27-28H,1-2,5-11H2/b26-17+ |
| InChIKey | LBMNWZJTXKBQSD-YZSQISJMSA-N |
| XLogP | 5.97 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|