C10H12N6O2 — CID 135966058
N-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl]aziridine-1-carboxamide (PubChem CID 135966058) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is N-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl]aziridine-1-carboxamide.
| Compound Name | N-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl]aziridine-1-carboxamide |
|---|---|
| PubChem CID | 135966058 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl]aziridine-1-carboxamide |
| SMILES | Nc1nc2[nH]cc(CNC(=O)N3CC3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N6O2/c11-9-14-7-6(8(17)15-9)5(3-12-7)4-13-10(18)16-1-2-16/h3H,1-2,4H2,(H,13,18)(H4,11,12,14,15,17) |
| InChIKey | ZBSWKILIGFAUOC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|