About 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid
2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid (PubChem CID 135966070) has the molecular formula C9H15N4O5P
and a molecular weight of 290.22 g/mol. Its IUPAC name is 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid.
Molecular Properties
| Compound Name | 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid |
| PubChem CID | 135966070 |
| Molecular Formula | C9H15N4O5P |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid |
| SMILES | O=c1[nH]cnc2c1NCN2CCOCCP(=O)(O)O |
| InChI | InChI=1S/C9H15N4O5P/c14-9-7-8(10-5-11-9)13(6-12-7)1-2-18-3-4-19(15,16)17/h5,12H,1-4,6H2,(H,10,11,14)(H2,15,16,17) |
| InChIKey | FWNFOZMUZNIOND-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid?
The IUPAC name of 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid (CID 135966070) is 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid.
What is the SMILES notation for 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid?
The canonical SMILES for 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid is O=c1[nH]cnc2c1NCN2CCOCCP(=O)(O)O.
What is the InChIKey of 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid?
The InChIKey is FWNFOZMUZNIOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N4O5P/c14-9-7-8(10-5-11-9)13(6-12-7)1-2-18-3-4-19(15,16)17/h5,12H,1-4,6H2,(H,10,11,14)(H2,15,16,17).
What are the key properties of 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid?
2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid has a molecular weight of 290.22 g/mol, XLogP of -0.85, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6-oxo-7,8-dihydro-1H-purin-9-yl)ethoxy]ethylphosphonic acid is sourced from PubChem (CID 135966070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).