About 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one
3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one (PubChem CID 135966133) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one |
| PubChem CID | 135966133 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(c2ccc[nH]2)=NN1 |
| InChI | InChI=1S/C7H7N3O/c11-7-4-6(9-10-7)5-2-1-3-8-5/h1-3,8H,4H2,(H,10,11) |
| InChIKey | UUYYATWPJITSRC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one?
The IUPAC name of 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one (CID 135966133) is 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one is O=C1CC(c2ccc[nH]2)=NN1.
What is the InChIKey of 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one?
The InChIKey is UUYYATWPJITSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c11-7-4-6(9-10-7)5-2-1-3-8-5/h1-3,8H,4H2,(H,10,11).
What are the key properties of 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one?
3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one has a molecular weight of 149.15 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-pyrrol-2-yl)-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 135966133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).