About 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide
2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 135966346) has the molecular formula C16H19N5O3S
and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 135966346 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCc1nc(C2CCN(C(=O)C(=O)Nc3nccs3)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H19N5O3S/c1-2-12-18-11(9-13(22)19-12)10-3-6-21(7-4-10)15(24)14(23)20-16-17-5-8-25-16/h5,8-10H,2-4,6-7H2,1H3,(H,17,20,23)(H,18,19,22) |
| InChIKey | JIJQNXWBWXTPOV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide (CID 135966346) is 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide is CCc1nc(C2CCN(C(=O)C(=O)Nc3nccs3)CC2)cc(=O)[nH]1.
What is the InChIKey of 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is JIJQNXWBWXTPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O3S/c1-2-12-18-11(9-13(22)19-12)10-3-6-21(7-4-10)15(24)14(23)20-16-17-5-8-25-16/h5,8-10H,2-4,6-7H2,1H3,(H,17,20,23)(H,18,19,22).
What are the key properties of 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide?
2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 361.43 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-ethyl-6-oxo-1H-pyrimidin-4-yl)piperidin-1-yl]-2-oxo-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 135966346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).