About oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol
oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol (PubChem CID 135967294) has the molecular formula C15H9F6NO2V
and a molecular weight of 400.17 g/mol. Its IUPAC name is oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol |
| PubChem CID | 135967294 |
| Molecular Formula | C15H9F6NO2V |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol |
| SMILES | O=[V].Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1/C=N/c1ccccc1 |
| InChI | InChI=1S/C15H9F6NO.O.V/c16-14(17,18)9-6-12(15(19,20)21)11(13(23)7-9)8-22-10-4-2-1-3-5-10;;/h1-8,23H;;/b22-8+;; |
| InChIKey | NUWDWOULWMOSNX-SQZQNVTESA-N |
| XLogP | 5.06 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol?
The IUPAC name of oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol (CID 135967294) is oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol.
What is the SMILES notation for oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol?
The canonical SMILES for oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol is O=[V].Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1/C=N/c1ccccc1.
What is the InChIKey of oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol?
The InChIKey is NUWDWOULWMOSNX-SQZQNVTESA-N. The full InChI is InChI=1S/C15H9F6NO.O.V/c16-14(17,18)9-6-12(15(19,20)21)11(13(23)7-9)8-22-10-4-2-1-3-5-10;;/h1-8,23H;;/b22-8+;;.
What are the key properties of oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol?
oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol has a molecular weight of 400.17 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxovanadium;2-(phenyliminomethyl)-3,5-bis(trifluoromethyl)phenol is sourced from PubChem (CID 135967294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).