About oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide
oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide (PubChem CID 135967319) has the molecular formula C16H16BrNO2V
and a molecular weight of 385.16 g/mol. Its IUPAC name is oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide.
Molecular Properties
| Compound Name | oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide |
| PubChem CID | 135967319 |
| Molecular Formula | C16H16BrNO2V |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide |
| SMILES | Br.O=[V].Oc1cc2c(cc1/C=N/c1ccccc1)CCC2 |
| InChI | InChI=1S/C16H15NO.BrH.O.V/c18-16-10-13-6-4-5-12(13)9-14(16)11-17-15-7-2-1-3-8-15;;;/h1-3,7-11,18H,4-6H2;1H;;/b17-11+;;; |
| InChIKey | MTJDPJALCHOXNY-IPPFNBFJSA-N |
| XLogP | 4.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide?
The IUPAC name of oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide (CID 135967319) is oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide.
What is the SMILES notation for oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide?
The canonical SMILES for oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide is Br.O=[V].Oc1cc2c(cc1/C=N/c1ccccc1)CCC2.
What is the InChIKey of oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide?
The InChIKey is MTJDPJALCHOXNY-IPPFNBFJSA-N. The full InChI is InChI=1S/C16H15NO.BrH.O.V/c18-16-10-13-6-4-5-12(13)9-14(16)11-17-15-7-2-1-3-8-15;;;/h1-3,7-11,18H,4-6H2;1H;;/b17-11+;;;.
What are the key properties of oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide?
oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide has a molecular weight of 385.16 g/mol, XLogP of 4.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxovanadium;6-(phenyliminomethyl)-2,3-dihydro-1H-inden-5-ol;hydrobromide is sourced from PubChem (CID 135967319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).