C24H29IrN2OS- — CID 135967414
2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-(3H-thiophen-3-id-2-yl)pyridine (PubChem CID 135967414) has the molecular formula C24H29IrN2OS- and a molecular weight of 585.79 g/mol. Its IUPAC name is 2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-(3H-thiophen-3-id-2-yl)pyridine.
| Compound Name | 2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-(3H-thiophen-3-id-2-yl)pyridine |
|---|---|
| PubChem CID | 135967414 |
| Molecular Formula | C24H29IrN2OS- |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-(3H-thiophen-3-id-2-yl)pyridine |
| SMILES | CCCCCC/N=C/c1cc(C)cc(C)c1O.[Ir].[c-]1ccsc1-c1ccccn1 |
| InChI | InChI=1S/C15H23NO.C9H6NS.Ir/c1-4-5-6-7-8-16-11-14-10-12(2)9-13(3)15(14)17;1-2-6-10-8(4-1)9-5-3-7-11-9;/h9-11,17H,4-8H2,1-3H3;1-4,6-7H;/q;-1;/b16-11+;; |
| InChIKey | HXVBBUIUPMRGDR-RPVSWQTKSA-N |
| XLogP | 6.62 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|