About 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol
4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol (PubChem CID 135967654) has the molecular formula C19H19N3O4S
and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol.
Molecular Properties
| Compound Name | 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol |
| PubChem CID | 135967654 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol |
| SMILES | O=S(=O)(c1cccc(-c2ccc(O)cc2)n1)N1CCC(c2cnco2)CC1 |
| InChI | InChI=1S/C19H19N3O4S/c23-16-6-4-14(5-7-16)17-2-1-3-19(21-17)27(24,25)22-10-8-15(9-11-22)18-12-20-13-26-18/h1-7,12-13,15,23H,8-11H2 |
| InChIKey | MTLKAXHJYCSMPM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol?
The IUPAC name of 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol (CID 135967654) is 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol.
What is the SMILES notation for 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol?
The canonical SMILES for 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol is O=S(=O)(c1cccc(-c2ccc(O)cc2)n1)N1CCC(c2cnco2)CC1.
What is the InChIKey of 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol?
The InChIKey is MTLKAXHJYCSMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4S/c23-16-6-4-14(5-7-16)17-2-1-3-19(21-17)27(24,25)22-10-8-15(9-11-22)18-12-20-13-26-18/h1-7,12-13,15,23H,8-11H2.
What are the key properties of 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol?
4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol has a molecular weight of 385.45 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenol is sourced from PubChem (CID 135967654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).