C24H26N8O9 — CID 135967796
(4S)-4-amino-5-[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]oxy-5-oxopentanoic acid (PubChem CID 135967796) has the molecular formula C24H26N8O9 and a molecular weight of 570.52 g/mol. Its IUPAC name is (4S)-4-amino-5-[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]oxy-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135967796 |
| Molecular Formula | C24H26N8O9 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | (4S)-4-amino-5-[4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-4-carboxybutanoyl]oxy-5-oxopentanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)NC(CCC(=O)OC(=O)[C@@H](N)CCC(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H26N8O9/c25-14(5-7-16(33)34)23(40)41-17(35)8-6-15(22(38)39)30-20(36)11-1-3-12(4-2-11)27-9-13-10-28-19-18(29-13)21(37)32-24(26)31-19/h1-4,10,14-15,27H,5-9,25H2,(H,30,36)(H,33,34)(H,38,39)(H3,26,28,31,32,37)/t14-,15?/m0/s1 |
| InChIKey | FJUSJWBIWLXZEN-MLCCFXAWSA-N |
| XLogP | -0.87 |
| TPSA | 282.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|