C20H19Cl2N5O3S — CID 135967827
5-[4-(2,5-dichlorophenoxy)anilino]-N'-morpholin-4-yl-3-oxo-1,2-thiazole-4-carboximidamide (PubChem CID 135967827) has the molecular formula C20H19Cl2N5O3S and a molecular weight of 480.38 g/mol. Its IUPAC name is 5-[4-(2,5-dichlorophenoxy)anilino]-N'-morpholin-4-yl-3-oxo-1,2-thiazole-4-carboximidamide.
| Compound Name | 5-[4-(2,5-dichlorophenoxy)anilino]-N'-morpholin-4-yl-3-oxo-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 135967827 |
| Molecular Formula | C20H19Cl2N5O3S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 5-[4-(2,5-dichlorophenoxy)anilino]-N'-morpholin-4-yl-3-oxo-1,2-thiazole-4-carboximidamide |
| SMILES | N/C(=N\N1CCOCC1)c1c(Nc2ccc(Oc3cc(Cl)ccc3Cl)cc2)s[nH]c1=O |
| InChI | InChI=1S/C20H19Cl2N5O3S/c21-12-1-6-15(22)16(11-12)30-14-4-2-13(3-5-14)24-20-17(19(28)26-31-20)18(23)25-27-7-9-29-10-8-27/h1-6,11,24H,7-10H2,(H2,23,25)(H,26,28) |
| InChIKey | IJORGGQZMMIYIS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|