C21H27N3O2 — CID 135967863
[(E)-(3-ethyl-2-methyl-1,5,6,7-tetrahydroindol-4-ylidene)amino] N-(4-propan-2-ylphenyl)carbamate (PubChem CID 135967863) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [(E)-(3-ethyl-2-methyl-1,5,6,7-tetrahydroindol-4-ylidene)amino] N-(4-propan-2-ylphenyl)carbamate.
| Compound Name | [(E)-(3-ethyl-2-methyl-1,5,6,7-tetrahydroindol-4-ylidene)amino] N-(4-propan-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 135967863 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [(E)-(3-ethyl-2-methyl-1,5,6,7-tetrahydroindol-4-ylidene)amino] N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CCc1c(C)[nH]c2c1/C(=N/OC(=O)Nc1ccc(C(C)C)cc1)CCC2 |
| InChI | InChI=1S/C21H27N3O2/c1-5-17-14(4)22-18-7-6-8-19(20(17)18)24-26-21(25)23-16-11-9-15(10-12-16)13(2)3/h9-13,22H,5-8H2,1-4H3,(H,23,25)/b24-19+ |
| InChIKey | SMDKDHIRZSCNCD-LYBHJNIJSA-N |
| XLogP | 5.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|