C17H20N4O — CID 135967870
1-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]-3-phenylurea (PubChem CID 135967870) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]-3-phenylurea.
| Compound Name | 1-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]-3-phenylurea |
|---|---|
| PubChem CID | 135967870 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]-3-phenylurea |
| SMILES | Cc1[nH]c2c(c1C)/C(=N/NC(=O)Nc1ccccc1)CCC2 |
| InChI | InChI=1S/C17H20N4O/c1-11-12(2)18-14-9-6-10-15(16(11)14)20-21-17(22)19-13-7-4-3-5-8-13/h3-5,7-8,18H,6,9-10H2,1-2H3,(H2,19,21,22)/b20-15+ |
| InChIKey | VWYMRKOUEIQTHZ-HMMYKYKNSA-N |
| XLogP | 3.49 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|