C13H9ClO4 — CID 135969026
3-(4-chlorobenzoyl)-4-hydroxy-6-methylpyran-2-one (PubChem CID 135969026) has the molecular formula C13H9ClO4 and a molecular weight of 264.66 g/mol. Its IUPAC name is 3-(4-chlorobenzoyl)-4-hydroxy-6-methylpyran-2-one.
| Compound Name | 3-(4-chlorobenzoyl)-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 135969026 |
| Molecular Formula | C13H9ClO4 |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 3-(4-chlorobenzoyl)-4-hydroxy-6-methylpyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)c2ccc(Cl)cc2)c(=O)o1 |
| InChI | InChI=1S/C13H9ClO4/c1-7-6-10(15)11(13(17)18-7)12(16)8-2-4-9(14)5-3-8/h2-6,15H,1H3 |
| InChIKey | MOZDGCJIOIHXJU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |