C25H27N3O3S — CID 135969364
5-(2-butoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135969364) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 5-(2-butoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-butoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135969364 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 5-(2-butoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCCOc1ccccc1C1CC(=O)Nc2nc(SCc3ccc(C)cc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C25H27N3O3S/c1-3-4-13-31-20-8-6-5-7-18(20)19-14-21(29)26-23-22(19)24(30)28-25(27-23)32-15-17-11-9-16(2)10-12-17/h5-12,19H,3-4,13-15H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | VQMYPPVXYBQQQE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|