C21H24N4O5 — CID 135970233
5-[3-(2-ethoxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 135970233) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 5-[3-(2-ethoxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 5-[3-(2-ethoxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135970233 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 5-[3-(2-ethoxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(C2=NN(C(=O)CC)C(c3ccccc3OCC)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H24N4O5/c1-4-11-24-20(28)18(19(27)22-21(24)29)14-12-15(25(23-14)17(26)5-2)13-9-7-8-10-16(13)30-6-3/h4,7-10,15,28H,1,5-6,11-12H2,2-3H3,(H,22,27,29) |
| InChIKey | LFMBIYLGISTFJP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|