C28H32F2N8O5 — CID 135970803
ethyl 2-[4-[[2-(5-carbamimidoyl-2-hydroxyphenoxy)-6-[3-(diaminomethylideneamino)phenoxy]-3,5-difluoro-4-pyridinyl]amino]piperidin-1-yl]acetate (PubChem CID 135970803) has the molecular formula C28H32F2N8O5 and a molecular weight of 598.61 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(5-carbamimidoyl-2-hydroxyphenoxy)-6-[3-(diaminomethylideneamino)phenoxy]-3,5-difluoro-4-pyridinyl]amino]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[2-(5-carbamimidoyl-2-hydroxyphenoxy)-6-[3-(diaminomethylideneamino)phenoxy]-3,5-difluoro-4-pyridinyl]amino]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 135970803 |
| Molecular Formula | C28H32F2N8O5 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | ethyl 2-[4-[[2-(5-carbamimidoyl-2-hydroxyphenoxy)-6-[3-(diaminomethylideneamino)phenoxy]-3,5-difluoro-4-pyridinyl]amino]piperidin-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(O)c(Oc2nc(Oc3cccc(N=C(N)N)c3)c(F)c(NC3CCN(CC(=O)OCC)CC3)c2F)c1 |
| InChI | InChI=1S/C28H32F2N8O5/c1-2-41-21(40)14-38-10-8-16(9-11-38)35-24-22(29)26(42-18-5-3-4-17(13-18)36-28(33)34)37-27(23(24)30)43-20-12-15(25(31)32)6-7-19(20)39/h3-7,12-13,16,39H,2,8-11,14H2,1H3,(H3,31,32)(H,35,37)(H4,33,34,36) |
| InChIKey | BZPPAJDUTLFEPI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 207.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|