C22H21Cl2N3O4 — CID 135971136
(E)-3-(3,5-dichlorophenyl)-N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethylprop-2-enamide (PubChem CID 135971136) has the molecular formula C22H21Cl2N3O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 135971136 |
| Molecular Formula | C22H21Cl2N3O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethylprop-2-enamide |
| SMILES | CCN(Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1)C(=O)/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O4/c1-4-27(21(28)6-5-13-7-14(23)9-15(24)8-13)12-20-25-17-11-19(31-3)18(30-2)10-16(17)22(29)26-20/h5-11H,4,12H2,1-3H3,(H,25,26,29)/b6-5+ |
| InChIKey | RIZYQRHTMWVPSJ-AATRIKPKSA-N |
| XLogP | 4.31 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|