C26H26N6O2 — CID 135971871
4-[5-(3-aminoanilino)-4-(1-methylindol-5-yl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol (PubChem CID 135971871) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[5-(3-aminoanilino)-4-(1-methylindol-5-yl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol.
| Compound Name | 4-[5-(3-aminoanilino)-4-(1-methylindol-5-yl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 135971871 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-[5-(3-aminoanilino)-4-(1-methylindol-5-yl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol |
| SMILES | CC(C)c1cc(-c2nnc(Nc3cccc(N)c3)n2-c2ccc3c(ccn3C)c2)c(O)cc1O |
| InChI | InChI=1S/C26H26N6O2/c1-15(2)20-13-21(24(34)14-23(20)33)25-29-30-26(28-18-6-4-5-17(27)12-18)32(25)19-7-8-22-16(11-19)9-10-31(22)3/h4-15,33-34H,27H2,1-3H3,(H,28,30) |
| InChIKey | FCCBATACBZGWEY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|