C29H34ClN3O6 — CID 135971945
N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3,4,5-tetramethoxybenzamide (PubChem CID 135971945) has the molecular formula C29H34ClN3O6 and a molecular weight of 556.06 g/mol. Its IUPAC name is N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3,4,5-tetramethoxybenzamide.
| Compound Name | N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3,4,5-tetramethoxybenzamide |
|---|---|
| PubChem CID | 135971945 |
| Molecular Formula | C29H34ClN3O6 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3,4,5-tetramethoxybenzamide |
| SMILES | CCN(CC)c1ccc(/N=C2/C=C(NC(=O)c3cc(OC)c(OC)c(OC)c3OC)C(=O)C(Cl)=C2C)c(C)c1 |
| InChI | InChI=1S/C29H34ClN3O6/c1-9-33(10-2)18-11-12-20(16(3)13-18)31-21-15-22(25(34)24(30)17(21)4)32-29(35)19-14-23(36-5)27(38-7)28(39-8)26(19)37-6/h11-15H,9-10H2,1-8H3,(H,32,35)/b31-21- |
| InChIKey | IQTBQVLOHMGCHU-YQYKVWLJSA-N |
| XLogP | 5.36 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|