C14H11F4NO2 — CID 135972056
(Z)-3-(cyclopropyliminomethyl)-4-hydroxy-4-(2,3,4,5-tetrafluorophenyl)but-3-en-2-one (PubChem CID 135972056) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is (Z)-3-(cyclopropyliminomethyl)-4-hydroxy-4-(2,3,4,5-tetrafluorophenyl)but-3-en-2-one.
| Compound Name | (Z)-3-(cyclopropyliminomethyl)-4-hydroxy-4-(2,3,4,5-tetrafluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 135972056 |
| Molecular Formula | C14H11F4NO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (Z)-3-(cyclopropyliminomethyl)-4-hydroxy-4-(2,3,4,5-tetrafluorophenyl)but-3-en-2-one |
| SMILES | CC(=O)C(/C=N/C1CC1)=C(\O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H11F4NO2/c1-6(20)9(5-19-7-2-3-7)14(21)8-4-10(15)12(17)13(18)11(8)16/h4-5,7,21H,2-3H2,1H3/b14-9-,19-5+ |
| InChIKey | DJJNFQFIFZLAFD-ALECXDTRSA-N |
| XLogP | 3.33 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|