C11H15N5O3 — CID 135972447
2-amino-9-[(1R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one (PubChem CID 135972447) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-amino-9-[(1R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135972447 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-amino-9-[(1R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2C[C@H](CO)C2CO)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O3/c12-11-14-9-8(10(19)15-11)13-4-16(9)7-1-5(2-17)6(7)3-18/h4-7,17-18H,1-3H2,(H3,12,14,15,19)/t5-,6?,7-/m1/s1 |
| InChIKey | GWFOVSGRNGAGDL-YFBHCESUSA-N |
| XLogP | -1.14 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |