C25H30N4O6S — CID 135972935
2-[(E)-[5-[4-(dimethylsulfamoyl)phenyl]-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxypentanoic acid (PubChem CID 135972935) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is 2-[(E)-[5-[4-(dimethylsulfamoyl)phenyl]-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxypentanoic acid.
| Compound Name | 2-[(E)-[5-[4-(dimethylsulfamoyl)phenyl]-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxypentanoic acid |
|---|---|
| PubChem CID | 135972935 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[(E)-[5-[4-(dimethylsulfamoyl)phenyl]-8-methyl-2-oxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-3-ylidene]amino]oxypentanoic acid |
| SMILES | CCCC(O/N=C1/C(=O)Nc2c1cc(-c1ccc(S(=O)(=O)N(C)C)cc1)c1c2CN(C)CC1)C(=O)O |
| InChI | InChI=1S/C25H30N4O6S/c1-5-6-21(25(31)32)35-27-23-19-13-18(15-7-9-16(10-8-15)36(33,34)28(2)3)17-11-12-29(4)14-20(17)22(19)26-24(23)30/h7-10,13,21H,5-6,11-12,14H2,1-4H3,(H,31,32)(H,26,27,30) |
| InChIKey | ICUAOTUHIWLJQX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|