C16H20N2O5 — CID 135973046
methyl 4-[[2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]butanoate (PubChem CID 135973046) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 4-[[2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 135973046 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 4-[[2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CC1CC(c2ccc(O)cc2)=NO1 |
| InChI | InChI=1S/C16H20N2O5/c1-22-16(21)3-2-8-17-15(20)10-13-9-14(18-23-13)11-4-6-12(19)7-5-11/h4-7,13,19H,2-3,8-10H2,1H3,(H,17,20) |
| InChIKey | JFUCXJLNYFIJKX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|