About cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate
cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate (PubChem CID 135973115) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate |
| PubChem CID | 135973115 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate |
| SMILES | O=C(CC1CC(c2ccc(O)cc2)=NO1)OC1CCCCC1 |
| InChI | InChI=1S/C17H21NO4/c19-13-8-6-12(7-9-13)16-10-15(22-18-16)11-17(20)21-14-4-2-1-3-5-14/h6-9,14-15,19H,1-5,10-11H2 |
| InChIKey | MTZMMGKPBKFVFB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
The IUPAC name of cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate (CID 135973115) is cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate.
What is the SMILES notation for cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
The canonical SMILES for cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate is O=C(CC1CC(c2ccc(O)cc2)=NO1)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
The InChIKey is MTZMMGKPBKFVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c19-13-8-6-12(7-9-13)16-10-15(22-18-16)11-17(20)21-14-4-2-1-3-5-14/h6-9,14-15,19H,1-5,10-11H2.
What are the key properties of cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate?
cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate has a molecular weight of 303.36 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate is sourced from PubChem (CID 135973115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).